ethyl 3-amino-2,4-dicyano-4-(phenylhydrazinylidene)but-2-enoate structure
|
Common Name | ethyl 3-amino-2,4-dicyano-4-(phenylhydrazinylidene)but-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 87831-18-3 | Molecular Weight | 283.28500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 3-amino-2,4-dicyano-4-(phenylhydrazinylidene)but-2-enoate |
|---|
| Molecular Formula | C14H13N5O2 |
|---|---|
| Molecular Weight | 283.28500 |
| Exact Mass | 283.10700 |
| PSA | 124.29000 |
| LogP | 2.05086 |
| InChIKey | CKLKYDYHXPXRFH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C#N)=C(N)C(C#N)=NNc1ccccc1 |
|
~77%
ethyl 3-amino-2... CAS#:87831-18-3 |
| Literature: Sadek; Fahmy; Mohareb; Elnagdi Journal of Chemical and Engineering Data, 1984 , vol. 29, # 1 p. 101 - 103 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |