2,4-Dichlorophenyl sorbate
Modify Date: 2025-09-09 20:05:35
2,4-Dichlorophenyl sorbate structure
|
Common Name | 2,4-Dichlorophenyl sorbate | ||
|---|---|---|---|---|
| CAS Number | 878542-34-8 | Molecular Weight | 257.11 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-Dichlorophenyl sorbate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H10Cl2O2 |
|---|---|
| Molecular Weight | 257.11 |
| InChIKey | ZNSORYBRTRPGHT-MQQKCMAXSA-N |
| SMILES | CC=CC=CC(=O)Oc1ccc(Cl)cc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2,4-Dichlorophenyl sorbate? |
| A: Molecular formula of 2,4-Dichlorophenyl sorbate is C12H10Cl2O2. |
| Q: What is the English name of 2,4-Dichlorophenyl sorbate? |
| A: The English name of 2,4-Dichlorophenyl sorbate is 2,4-Dichlorophenyl sorbate. |
| Q: What is the SMILES notation of 2,4-Dichlorophenyl sorbate? |
| A: SMILES notation of 2,4-Dichlorophenyl sorbate is CC=CC=CC(=O)Oc1ccc(Cl)cc1Cl. |
| Q: What is the InChIKey of 2,4-Dichlorophenyl sorbate? |
| A: InChIKey of 2,4-Dichlorophenyl sorbate is ZNSORYBRTRPGHT-MQQKCMAXSA-N. |
| Q: What is the CAS number of 2,4-Dichlorophenyl sorbate? |
| A: CAS number of 2,4-Dichlorophenyl sorbate is 878542-34-8. |
| Q: What is the Chinese name of 878542-34-8? |
| A: Chinese name of 878542-34-8 is 878542-34-8. |
| Q: What is the molecular weight of 2,4-Dichlorophenyl sorbate? |
| A: Molecular weight of 2,4-Dichlorophenyl sorbate is 257.11. |