PD 113270 structure
|
Common Name | PD 113270 | ||
|---|---|---|---|---|
| CAS Number | 87860-37-5 | Molecular Weight | 414.38700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H27O8P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PD 113270PD 113270 (CL 1565-B) is an antitumor agent. PD 113270 exhibits inhibitory effects to yeasts[1]. |
| Name | [(1E,7E,9E,11E)-3,6-dihydroxy-3-methyl-1-(6-oxo-2,3-dihydropyran-2-yl)trideca-1,7,9,11-tetraen-4-yl] dihydrogen phosphate |
|---|---|
| Synonym | More Synonyms |
| Description | PD 113270 (CL 1565-B) is an antitumor agent. PD 113270 exhibits inhibitory effects to yeasts[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C19H27O8P |
|---|---|
| Molecular Weight | 414.38700 |
| Exact Mass | 414.14400 |
| PSA | 143.33000 |
| LogP | 2.08270 |
| InChIKey | MQLGXVOINDPKQT-BVOZHDEJSA-N |
| SMILES | CC=CC=CC=CC(O)CC(OP(=O)(O)O)C(C)(O)C=CC1CC=CC(=O)O1 |
| CL 1565-B |
| PD-113,270 |
| Antibiotic CL 1565B |