1-[[4-(trifluoromethyl)phenyl]methyl]quinolin-1-ium-3-carbonitrile,bromide structure
|
Common Name | 1-[[4-(trifluoromethyl)phenyl]methyl]quinolin-1-ium-3-carbonitrile,bromide | ||
|---|---|---|---|---|
| CAS Number | 87861-96-9 | Molecular Weight | 393.20000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H12BrF3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[[4-(trifluoromethyl)phenyl]methyl]quinolin-1-ium-3-carbonitrile,bromide |
|---|
| Molecular Formula | C18H12BrF3N2 |
|---|---|
| Molecular Weight | 393.20000 |
| Exact Mass | 392.01400 |
| PSA | 27.67000 |
| LogP | 1.07008 |
| InChIKey | TUZNKEXEZTYVNC-UHFFFAOYSA-M |
| SMILES | N#Cc1cc2ccccc2[n+](Cc2ccc(C(F)(F)F)cc2)c1.[Br-] |
|
~%
1-[[4-(trifluor... CAS#:87861-96-9 |
| Literature: Ostovic, Drazen; Roberts, Roger M. G.; Kreevoy, Mourice M. Journal of the American Chemical Society, 1983 , vol. 105, # 26 p. 7629 - 7631 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |