5-[[4-(trifluoromethyl)phenyl]methyl]phenanthridin-5-ium,bromide structure
|
Common Name | 5-[[4-(trifluoromethyl)phenyl]methyl]phenanthridin-5-ium,bromide | ||
|---|---|---|---|---|
| CAS Number | 87861-99-2 | Molecular Weight | 418.25000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H15BrF3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[[4-(trifluoromethyl)phenyl]methyl]phenanthridin-5-ium,bromide |
|---|
| Molecular Formula | C21H15BrF3N |
|---|---|
| Molecular Weight | 418.25000 |
| Exact Mass | 417.03400 |
| PSA | 3.88000 |
| LogP | 2.35160 |
| InChIKey | TWWDMVOEFOLPSO-UHFFFAOYSA-M |
| SMILES | FC(F)(F)c1ccc(C[n+]2cc3ccccc3c3ccccc32)cc1.[Br-] |
|
~%
5-[[4-(trifluor... CAS#:87861-99-2 |
| Literature: Ostovic, Drazen; Roberts, Roger M. G.; Kreevoy, Mourice M. Journal of the American Chemical Society, 1983 , vol. 105, # 26 p. 7629 - 7631 |