N-[[2-(furan-2-carbonylcarbamothioylamino)phenyl]carbamothioyl]furan-2-carboxamide structure
|
Common Name | N-[[2-(furan-2-carbonylcarbamothioylamino)phenyl]carbamothioyl]furan-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 87874-17-7 | Molecular Weight | 414.45800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H14N4O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[[2-(furan-2-carbonylcarbamothioylamino)phenyl]carbamothioyl]furan-2-carboxamide |
|---|
| Molecular Formula | C18H14N4O4S2 |
|---|---|
| Molecular Weight | 414.45800 |
| Exact Mass | 414.04600 |
| PSA | 193.78000 |
| LogP | 4.71680 |
| InChIKey | GHVGSZWVIPGWFA-UHFFFAOYSA-N |
| SMILES | O=C(NC(=S)Nc1ccccc1NC(=S)NC(=O)c1ccco1)c1ccco1 |
|
~%
N-[[2-(furan-2-... CAS#:87874-17-7 |
| Literature: Zhang; Wei; Gao Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2000 , vol. 39, # 9 p. 700 - 702 |
|
~%
N-[[2-(furan-2-... CAS#:87874-17-7 |
| Literature: Zhang; Wei; Gao Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2000 , vol. 39, # 9 p. 700 - 702 |
|
~%
N-[[2-(furan-2-... CAS#:87874-17-7 |
| Literature: Uher, Michal; Berkes, Dusan; Lesko, Jan; Floch, Lubomir Collection of Czechoslovak Chemical Communications, 1983 , vol. 48, # 6 p. 1651 - 1658 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |