N-(3-carbamoyl-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl)isoxazole-5-carboxamide
Modify Date: 2026-06-25 21:36:35
![N-(3-carbamoyl-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl)isoxazole-5-carboxamide Structure](https://www.chemsrc.com/extcaspic/020/879144-93-1.png)
N-(3-carbamoyl-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl)isoxazole-5-carboxamide structure
|
Common Name | N-(3-carbamoyl-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl)isoxazole-5-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 879144-93-1 | Molecular Weight | 291.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(3-carbamoyl-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl)isoxazole-5-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H13N3O3S |
|---|---|
| Molecular Weight | 291.33 |
| InChIKey | XYAVOVWZUBKYCY-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=C(S2)NC(=O)C3=CC=NO3)C(=O)N |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Primary screen in NF54 nanoGlo assay, in single point, at 2uM, 72h
Source: ChEMBL
Target: Plasmodium falciparum
External Id: CHEMBL4888485
|
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|
Total 2, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of N-(3-carbamoyl-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl)isoxazole-5-carboxamide? |
| A: Molecular weight of N-(3-carbamoyl-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl)isoxazole-5-carboxamide is 291.33. |
| Q: What is the Chinese name of 879144-93-1? |
| A: Chinese name of 879144-93-1 is 879144-93-1. |
| Q: What is the InChIKey of N-(3-carbamoyl-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl)isoxazole-5-carboxamide? |
| A: InChIKey of N-(3-carbamoyl-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl)isoxazole-5-carboxamide is XYAVOVWZUBKYCY-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N-(3-carbamoyl-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl)isoxazole-5-carboxamide? |
| A: SMILES notation of N-(3-carbamoyl-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl)isoxazole-5-carboxamide is C1CCC2=C(C1)C(=C(S2)NC(=O)C3=CC=NO3)C(=O)N. |
| Q: What is the CAS number of N-(3-carbamoyl-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl)isoxazole-5-carboxamide? |
| A: CAS number of N-(3-carbamoyl-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl)isoxazole-5-carboxamide is 879144-93-1. |
| Q: What is the molecular formula of N-(3-carbamoyl-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl)isoxazole-5-carboxamide? |
| A: Molecular formula of N-(3-carbamoyl-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl)isoxazole-5-carboxamide is C13H13N3O3S. |
| Q: What is the English name of N-(3-carbamoyl-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl)isoxazole-5-carboxamide? |
| A: The English name of N-(3-carbamoyl-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl)isoxazole-5-carboxamide is N-(3-carbamoyl-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl)isoxazole-5-carboxamide. |