Eprobemide structure
|
Common Name | Eprobemide | ||
|---|---|---|---|---|
| CAS Number | 87940-60-1 | Molecular Weight | 282.76600 | |
| Density | 1.181g/cm3 | Boiling Point | 461.2ºC at 760 mmHg | |
| Molecular Formula | C14H19ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.7ºC | |
Use of EprobemideEprobemide is a non-competitive reversible inhibitor of monoamine oxidase A. |
| Name | 4-chloro-N-(3-morpholin-4-ylpropyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Description | Eprobemide is a non-competitive reversible inhibitor of monoamine oxidase A. |
|---|---|
| Related Catalog | |
| Target |
Monoamine oxidase A[1][2] |
| In Vitro | Eprobemide is a pharmaceutical drug that is used as an antidepressant. Eprobemide is a non-competitive reversible inhibitor of monoamine oxidase A that exhibits selective action on serotonin deamination[1][2]. |
| References |
| Density | 1.181g/cm3 |
|---|---|
| Boiling Point | 461.2ºC at 760 mmHg |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.76600 |
| Flash Point | 232.7ºC |
| Exact Mass | 282.11400 |
| PSA | 41.57000 |
| LogP | 2.12090 |
| Index of Refraction | 1.545 |
| InChIKey | YYFGRAGNYHYWEZ-UHFFFAOYSA-N |
| SMILES | O=C(NCCCN1CCOCC1)c1ccc(Cl)cc1 |
| Storage condition | 2-8℃ |
| 4-chloro-N-[3-(morpholin-4-yl)propyl]benzamide |
| Eprobemide |