5-(Tert-butyl)-3-(p-tolyl)pyrazolo[1,5-a]pyrimidin-7-ol structure
|
Common Name | 5-(Tert-butyl)-3-(p-tolyl)pyrazolo[1,5-a]pyrimidin-7-ol | ||
|---|---|---|---|---|
| CAS Number | 879477-75-5 | Molecular Weight | 281.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(Tert-butyl)-3-(p-tolyl)pyrazolo[1,5-a]pyrimidin-7-ol |
|---|
| Molecular Formula | C17H19N3O |
|---|---|
| Molecular Weight | 281.35 |
| InChIKey | YVGGQIBDKCVXGS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CNN3C2=NC(=CC3=O)C(C)(C)C |
|
Name: High Throughput Screening of small molecules that kill Mycobacterium tuberculosis
Source: 15607
Target: N/A
External Id: Cornell_MTB_2017
|