6-Phenyl-1,2,3,3a,5,6,7,7a-octahydroindazol-4-one
Modify Date: 2026-07-01 10:13:13
6-Phenyl-1,2,3,3a,5,6,7,7a-octahydroindazol-4-one structure
|
Common Name | 6-Phenyl-1,2,3,3a,5,6,7,7a-octahydroindazol-4-one | ||
|---|---|---|---|---|
| CAS Number | 879617-10-4 | Molecular Weight | 216.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-Phenyl-1,2,3,3a,5,6,7,7a-octahydroindazol-4-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16N2O |
|---|---|
| Molecular Weight | 216.28 |
| InChIKey | BVKNVLIVHUHOMM-UHFFFAOYSA-N |
| SMILES | O=C1CC(c2ccccc2)CC2NNCC12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 6-Phenyl-1,2,3,3a,5,6,7,7a-octahydroindazol-4-one? |
| A: The English name of 6-Phenyl-1,2,3,3a,5,6,7,7a-octahydroindazol-4-one is 6-Phenyl-1,2,3,3a,5,6,7,7a-octahydroindazol-4-one. |
| Q: What is the InChIKey of 6-Phenyl-1,2,3,3a,5,6,7,7a-octahydroindazol-4-one? |
| A: InChIKey of 6-Phenyl-1,2,3,3a,5,6,7,7a-octahydroindazol-4-one is BVKNVLIVHUHOMM-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 6-Phenyl-1,2,3,3a,5,6,7,7a-octahydroindazol-4-one? |
| A: Molecular formula of 6-Phenyl-1,2,3,3a,5,6,7,7a-octahydroindazol-4-one is C13H16N2O. |
| Q: What is the SMILES notation of 6-Phenyl-1,2,3,3a,5,6,7,7a-octahydroindazol-4-one? |
| A: SMILES notation of 6-Phenyl-1,2,3,3a,5,6,7,7a-octahydroindazol-4-one is O=C1CC(c2ccccc2)CC2NNCC12. |
| Q: What is the Chinese name of 879617-10-4? |
| A: Chinese name of 879617-10-4 is 879617-10-4. |
| Q: What is the molecular weight of 6-Phenyl-1,2,3,3a,5,6,7,7a-octahydroindazol-4-one? |
| A: Molecular weight of 6-Phenyl-1,2,3,3a,5,6,7,7a-octahydroindazol-4-one is 216.28. |
| Q: What is the CAS number of 6-Phenyl-1,2,3,3a,5,6,7,7a-octahydroindazol-4-one? |
| A: CAS number of 6-Phenyl-1,2,3,3a,5,6,7,7a-octahydroindazol-4-one is 879617-10-4. |