5-ethyl-4,5-dimethyl-N-phenyl-1,3,4-thiadiazol-2-amine structure
|
Common Name | 5-ethyl-4,5-dimethyl-N-phenyl-1,3,4-thiadiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 87976-09-8 | Molecular Weight | 235.34800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-ethyl-4,5-dimethyl-N-phenyl-1,3,4-thiadiazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H17N3S |
|---|---|
| Molecular Weight | 235.34800 |
| Exact Mass | 235.11400 |
| PSA | 52.93000 |
| LogP | 3.25020 |
| InChIKey | TUCOSTZBZOXDRW-UHFFFAOYSA-N |
| SMILES | CCC1(C)SC(=Nc2ccccc2)NN1C |
|
~46%
5-ethyl-4,5-dim... CAS#:87976-09-8 |
| Literature: Yamamoto, Iwao; Abe, Ikuo; Nozawa, Muneharu; Kotani, Mitsuhiro; Motoyoshiya, Jiro; et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2297 - 2301 |
|
~%
5-ethyl-4,5-dim... CAS#:87976-09-8 |
| Literature: Yamamoto, Iwao; Abe, Ikuo; Nozawa, Muneharu; Kotani, Mitsuhiro; Motoyoshiya, Jiro; et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2297 - 2301 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 5-anilino-2-ethyl-2,3-dimethyl-2,3-dihydro-1,3,4-thiadiazole |
| 1,3,4-Thiadiazol-2-amine,5-ethyl-4,5-dihydro-4,5-dimethyl-N-phenyl |