4,4-dimethyl-1,3-diphenyl-5-sulfanylideneimidazolidin-2-one structure
|
Common Name | 4,4-dimethyl-1,3-diphenyl-5-sulfanylideneimidazolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 87976-11-2 | Molecular Weight | 296.38700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,4-dimethyl-1,3-diphenyl-5-sulfanylideneimidazolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H16N2OS |
|---|---|
| Molecular Weight | 296.38700 |
| Exact Mass | 296.09800 |
| PSA | 55.64000 |
| LogP | 4.36920 |
| InChIKey | RIBOUUNXUSYIER-UHFFFAOYSA-N |
| SMILES | CC1(C)C(=S)N(c2ccccc2)C(=O)N1c1ccccc1 |
|
~21%
4,4-dimethyl-1,... CAS#:87976-11-2 |
| Literature: Yamamoto, Iwao; Abe, Ikuo; Nozawa, Muneharu; Kotani, Mitsuhiro; Motoyoshiya, Jiro; et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2297 - 2301 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-Imidazolidinone,4,4-dimethyl-1,3-diphenyl-5-thioxo |
| 4,4-dimethyl-1,3-diphenyl-5-thioxoimidazolidin-2-one |