13-HOTrE(r) structure
|
Common Name | 13-HOTrE(r) | ||
|---|---|---|---|---|
| CAS Number | 87984-82-5 | Molecular Weight | 294.429 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 436.5±33.0 °C at 760 mmHg | |
| Molecular Formula | C18H30O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.9±21.9 °C | |
Use of 13-HOTrE(r)13(S)-HOTrE is the 15-lipoxygenase (15-LO) product of linolenic acid. |
| Name | (13S)-13-hydroxyoctadeca-9,11,15-trienoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 436.5±33.0 °C at 760 mmHg |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.429 |
| Flash Point | 231.9±21.9 °C |
| Exact Mass | 294.219482 |
| PSA | 57.53000 |
| LogP | 4.88 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.505 |
| InChIKey | KLLGGGQNRTVBSU-FQSPHKRJSA-N |
| SMILES | CCC=CCC(O)C=CC=CCCCCCCCC(=O)O |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| (6Z,9Z,11E,13S)-13-Hydroxy-6,9,11-octadecatrienoic acid |
| 13-HOTrE(r) |
| 6,9,11-Octadecatrienoic acid, 13-hydroxy-, (6Z,9Z,11E,13S)- |