6-(3-propylanilino)-1H-pyrimidine-2,4-dione
Modify Date: 2025-09-12 19:55:28
6-(3-propylanilino)-1H-pyrimidine-2,4-dione structure
|
Common Name | 6-(3-propylanilino)-1H-pyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 87986-18-3 | Molecular Weight | 245.27700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(3-propylanilino)-1H-pyrimidine-2,4-dione |
|---|
| Molecular Formula | C13H15N3O2 |
|---|---|
| Molecular Weight | 245.27700 |
| Exact Mass | 245.11600 |
| PSA | 78.27000 |
| LogP | 2.65690 |
| InChIKey | NXUZJMJSGGDUHI-UHFFFAOYSA-N |
| SMILES | CCCc1cccc(Nc2cc(=O)[nH]c(=O)[nH]2)c1 |
|
~43%
6-(3-propylanil... CAS#:87986-18-3 |
| Literature: Wright, George E.; Gambino, Joseph J. Journal of Medicinal Chemistry, 1984 , vol. 27, # 2 p. 181 - 185 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: Inhibition constant against Bacillus subtilis DNA topoisomerase III (wild type).
Source: ChEMBL
Target: DNA topoisomerase 3
External Id: CHEMBL663871
|
|
Name: Inhibition constant against Bacillus subtilis azp-12 DNA topoisomerase III (mutant en...
Source: ChEMBL
Target: DNA topoisomerase 3
External Id: CHEMBL858266
|
Total 2, Current Page 1 of 1
1