trimethyl-(5-nitrofuran-2-yl)azanium,bromide
trimethyl-(5-nitrofuran-2-yl)azanium,bromide structure
|
Common Name | trimethyl-(5-nitrofuran-2-yl)azanium,bromide | ||
|---|---|---|---|---|
| CAS Number | 87997-10-2 | Molecular Weight | 251.07800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H11BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | trimethyl-(5-nitrofuran-2-yl)azanium,bromide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H11BrN2O3 |
|---|---|
| Molecular Weight | 251.07800 |
| Exact Mass | 249.99500 |
| PSA | 58.96000 |
| InChIKey | GTDKRRNCNKHJFN-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)c1ccc([N+](=O)[O-])o1.[Br-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~76%
trimethyl-(5-ni... CAS#:87997-10-2 |
| Literature: Vegh, Daniel; Kovac, Jaroslav; Dandarova, Miloslava Collection of Czechoslovak Chemical Communications, 1983 , vol. 48, # 7 p. 1885 - 1890 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 4 | |
CAS#:59-82-5
CAS#:87997-15-7
CAS#:87997-17-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Furanaminium,N,N,N-trimethyl-5-nitro-,bromide |
| 5-nitro-2-furyltrimethylammonium bromide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does trimethyl-(5-nitrofuran-2-yl)azanium,bromide have? |
| A: English synonyms of trimethyl-(5-nitrofuran-2-yl)azanium,bromide: 2-Furanaminium,N,N,N-trimethyl-5-nitro-,bromide, 5-nitro-2-furyltrimethylammonium bromide. |
| Q: What is the polar surface area (PSA) of trimethyl-(5-nitrofuran-2-yl)azanium,bromide? |
| A: Polar surface area (PSA) of trimethyl-(5-nitrofuran-2-yl)azanium,bromide is 58.96000. |
| Q: What is the Chinese name of 87997-10-2? |
| A: Chinese name of 87997-10-2 is 87997-10-2. |
| Q: What is the molecular weight of trimethyl-(5-nitrofuran-2-yl)azanium,bromide? |
| A: Molecular weight of trimethyl-(5-nitrofuran-2-yl)azanium,bromide is 251.07800. |
| Q: What is the molecular formula of trimethyl-(5-nitrofuran-2-yl)azanium,bromide? |
| A: Molecular formula of trimethyl-(5-nitrofuran-2-yl)azanium,bromide is C7H11BrN2O3. |
| Q: What are the downstream products of trimethyl-(5-nitrofuran-2-yl)azanium,bromide? |
| A: Related downstream products(CAS) of trimethyl-(5-nitrofuran-2-yl)azanium,bromide: 59-82-5;87997-15-7;87997-17-9;4818-50-2. |
| Q: What is the CAS number of trimethyl-(5-nitrofuran-2-yl)azanium,bromide? |
| A: CAS number of trimethyl-(5-nitrofuran-2-yl)azanium,bromide is 87997-10-2. |
| Q: What is the English name of trimethyl-(5-nitrofuran-2-yl)azanium,bromide? |
| A: The English name of trimethyl-(5-nitrofuran-2-yl)azanium,bromide is trimethyl-(5-nitrofuran-2-yl)azanium,bromide. |
| Q: What is the InChIKey of trimethyl-(5-nitrofuran-2-yl)azanium,bromide? |
| A: InChIKey of trimethyl-(5-nitrofuran-2-yl)azanium,bromide is GTDKRRNCNKHJFN-UHFFFAOYSA-M. |
| Q: What are the upstream materials of trimethyl-(5-nitrofuran-2-yl)azanium,bromide? |
| A: Related upstream materials(CAS) of trimethyl-(5-nitrofuran-2-yl)azanium,bromide: 823-73-4;75-50-3. |