Benzenesulfonic acid,2-amino-5-chloro-4-ethyl
Modify Date: 2025-08-27 18:29:34
Benzenesulfonic acid,2-amino-5-chloro-4-ethyl structure
|
Common Name | Benzenesulfonic acid,2-amino-5-chloro-4-ethyl | ||
|---|---|---|---|---|
| CAS Number | 88-56-2 | Molecular Weight | 235.68800 | |
| Density | 1.479g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H10ClNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-5-chloro-4-ethylbenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.479g/cm3 |
|---|---|
| Molecular Formula | C8H10ClNO3S |
| Molecular Weight | 235.68800 |
| Exact Mass | 235.00700 |
| PSA | 88.77000 |
| LogP | 3.39330 |
| Index of Refraction | 1.604 |
| InChIKey | DJOIZOKQHNHZPN-UHFFFAOYSA-N |
| SMILES | CCc1cc(N)c(S(=O)(=O)O)cc1Cl |
| HS Code | 2921420090 |
|---|
|
~%
Benzenesulfonic... CAS#:88-56-2 |
| Literature: US35654 E1, ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1
| EINECS 201-840-2 |
| 5-chloro-2-amino-4-ethyl-benzenesulfonic acid |
| 2-amino-5-chloro-4-ethylbenzene-1-sulfonic acid |
| Benzenesulfonic acid,2-amino-5-chloro-4-ethyl |
| 2-amino-4-ethyl-5-chlorobenzenesulfonic acid |
| 2-amino-5-chloro-4-ethylbenzene sulfonic acid |