4-chloro-3,5-dinitrobenzenesulfonic acid structure
|
Common Name | 4-chloro-3,5-dinitrobenzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 88-91-5 | Molecular Weight | 282.61500 | |
| Density | 1.911 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H3ClN2O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chloro-3,5-dinitrobenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.911 g/cm3 |
|---|---|
| Molecular Formula | C6H3ClN2O7S |
| Molecular Weight | 282.61500 |
| Exact Mass | 281.93500 |
| PSA | 154.39000 |
| LogP | 3.53030 |
| Index of Refraction | 1.651 |
| InChIKey | ALVPDCHBQRCKRQ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)O)cc([N+](=O)[O-])c1Cl |
| HS Code | 2904909090 |
|---|
|
~%
4-chloro-3,5-di... CAS#:88-91-5 |
| Literature: Journal of the Chemical Society, , p. 1002 Org.Synth.Coll.Vol., , vol. IV, p. 364 |
|
~%
4-chloro-3,5-di... CAS#:88-91-5 |
| Literature: Chemische Berichte, , vol. 58, p. 1230 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-chloro-3,5-dinitro-benzenesulfonic acid |
| 4-Chlor-3.5-dinitro-benzol-sulfonsaeure-(1) |
| 4-Chlor-3.5-dinitro-phenylsulfonsaeure |
| 4-Chlor-3,5-dinitro-benzolsulfonsaeure |