(2-Oxo-2',3',5',6'-tetrahydrospiro[indole-3,4'-pyran]-1(2H)-yl)ac etic acid structure
|
Common Name | (2-Oxo-2',3',5',6'-tetrahydrospiro[indole-3,4'-pyran]-1(2H)-yl)ac etic acid | ||
|---|---|---|---|---|
| CAS Number | 880079-26-5 | Molecular Weight | 261.273 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 567.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C14H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 296.8±30.1 °C | |
| Name | (2-Oxo-2',3',5',6'-tetrahydrospiro[indole-3,4'-pyran]-1(2H)-yl)ac etic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 567.1±50.0 °C at 760 mmHg |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.273 |
| Flash Point | 296.8±30.1 °C |
| Exact Mass | 261.100098 |
| PSA | 66.84000 |
| LogP | 1.27 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | ASMFKWLEUFAWST-UHFFFAOYSA-N |
| SMILES | O=C(O)CN1C(=O)C2(CCOCC2)c2ccccc21 |
|
~%
(2-Oxo-2',3',5'... CAS#:880079-26-5 |
| Literature: MERCK and CO., INC. Patent: WO2008/130512 A1, 2008 ; Location in patent: Page/Page column 73 ; WO 2008/130512 A1 |
| Spiro[3H-indole-3,4'-[4H]pyran]-1(2H)-acetic acid, 2',3',5',6'-tetrahydro-2-oxo- |
| (2-Oxo-2',3',5',6'-tetrahydrospiro[indole-3,4'-pyran]-1(2H)-yl)acetic acid |
| (2-Oxo-2,3,3a,4,5,6-hexahydro-benzo[6,7]cyclohepta[1,2-b]furan-10b-yl)-essigsaeure-methylester |
| (2-oxo-2,3,3a,4,5,6-hexahydro-benzo[6,7]cyclohepta[1,2-b]furan-10b-yl)-acetic acid methyl ester |
| (2-oxo-2',3',5',6'-tetrahydrospiro[indole-3,4'-pyran]-2(1H)-yl)acetic acid |