[3-(1,3-dithiolan-2-yl)chromen-4-ylidene]hydrazine structure
|
Common Name | [3-(1,3-dithiolan-2-yl)chromen-4-ylidene]hydrazine | ||
|---|---|---|---|---|
| CAS Number | 88021-85-6 | Molecular Weight | 264.36600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12N2OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [3-(1,3-dithiolan-2-yl)chromen-4-ylidene]hydrazine |
|---|
| Molecular Formula | C12H12N2OS2 |
|---|---|
| Molecular Weight | 264.36600 |
| Exact Mass | 264.03900 |
| PSA | 102.12000 |
| LogP | 3.38610 |
| InChIKey | NMSXDIXBBLRWQC-UHFFFAOYSA-N |
| SMILES | NN=c1c(C2SCCS2)coc2ccccc12 |
|
~85%
[3-(1,3-dithiol... CAS#:88021-85-6 |
| Literature: Ghosh, Chandra Kanta; Bandyopadhyay, Chandrakanta; Morin, Christophe Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 1989 - 1994 |
|
~%
[3-(1,3-dithiol... CAS#:88021-85-6 |
| Literature: Ghosh, Chandra Kanta; Bandyopadhyay, Chandrakanta; Morin, Christophe Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 1989 - 1994 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |