4-methoxy-4-methyl-1-(4-nitrophenyl)dec-2-yn-1-one structure
|
Common Name | 4-methoxy-4-methyl-1-(4-nitrophenyl)dec-2-yn-1-one | ||
|---|---|---|---|---|
| CAS Number | 88022-57-5 | Molecular Weight | 317.38000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methoxy-4-methyl-1-(4-nitrophenyl)dec-2-yn-1-one |
|---|
| Molecular Formula | C18H23NO4 |
|---|---|
| Molecular Weight | 317.38000 |
| Exact Mass | 317.16300 |
| PSA | 72.12000 |
| LogP | 4.67960 |
| InChIKey | RXFBJAPYMMRROB-UHFFFAOYSA-N |
| SMILES | CCCCCCC(C)(C#CC(=O)c1ccc([N+](=O)[O-])cc1)OC |
|
~76%
4-methoxy-4-met... CAS#:88022-57-5 |
| Literature: Sokolov, I. E.; Zanina, A. S.; Shergina, S. I.; El'tsina, T. G.; Kotlyarevskii, I. L. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1983 , vol. 32, # 8 p. 1722 - 1724 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1983 , # 8 p. 1898 - 1900 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |