4-bromo-2,3,5-triphenyl-1,2,6-thiadiazine 1-oxide structure
|
Common Name | 4-bromo-2,3,5-triphenyl-1,2,6-thiadiazine 1-oxide | ||
|---|---|---|---|---|
| CAS Number | 88039-28-5 | Molecular Weight | 423.32600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H15BrN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-bromo-2,3,5-triphenyl-1,2,6-thiadiazine 1-oxide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H15BrN2OS |
|---|---|
| Molecular Weight | 423.32600 |
| Exact Mass | 422.00900 |
| PSA | 51.88000 |
| LogP | 5.70460 |
| InChIKey | MYYPMBSUNOXWAP-UHFFFAOYSA-N |
| SMILES | O=S1N=C(c2ccccc2)C(Br)=C(c2ccccc2)N1c1ccccc1 |
|
~80%
4-bromo-2,3,5-t... CAS#:88039-28-5 |
| Literature: Barluenga, Jose; Tomas, Miguel; Lopez-Ortiz, J. Francisco; Gotor, Vicente Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2273 - 2276 |
|
~%
4-bromo-2,3,5-t... CAS#:88039-28-5 |
| Literature: Barluenga, Jose; Tomas, Miguel; Lopez-Ortiz, J. Francisco; Gotor, Vicente Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2273 - 2276 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2H-1,2,6-Thiadiazine,4-bromo-2,3,5-triphenyl-,1-oxide |