4-chloro-1,3-bis(4-methylphenyl)-5-phenylpyrazole structure
|
Common Name | 4-chloro-1,3-bis(4-methylphenyl)-5-phenylpyrazole | ||
|---|---|---|---|---|
| CAS Number | 88039-33-2 | Molecular Weight | 358.86300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H19ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chloro-1,3-bis(4-methylphenyl)-5-phenylpyrazole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H19ClN2 |
|---|---|
| Molecular Weight | 358.86300 |
| Exact Mass | 358.12400 |
| PSA | 17.82000 |
| LogP | 6.47650 |
| InChIKey | PCVTWPAFQGIPPM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2nn(-c3ccc(C)cc3)c(-c3ccccc3)c2Cl)cc1 |
|
~72%
4-chloro-1,3-bi... CAS#:88039-33-2 |
| Literature: Barluenga, Jose; Tomas, Miguel; Lopez-Ortiz, J. Francisco; Gotor, Vicente Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2273 - 2276 |
|
~%
4-chloro-1,3-bi... CAS#:88039-33-2 |
| Literature: Barluenga, Jose; Tomas, Miguel; Lopez-Ortiz, J. Francisco; Gotor, Vicente Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2273 - 2276 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-chloro-5-phenyl-1,3-di-p-tolylpyrazole |