5-chloro-4-cyclohexyl-1-(4-methylphenyl)-6-phenylpyrimidin-2-one structure
|
Common Name | 5-chloro-4-cyclohexyl-1-(4-methylphenyl)-6-phenylpyrimidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 88039-40-1 | Molecular Weight | 378.89500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H23ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-chloro-4-cyclohexyl-1-(4-methylphenyl)-6-phenylpyrimidin-2-one |
|---|
| Molecular Formula | C23H23ClN2O |
|---|---|
| Molecular Weight | 378.89500 |
| Exact Mass | 378.15000 |
| PSA | 34.89000 |
| LogP | 5.90900 |
| InChIKey | RAXMFSYLWYJBKO-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-n2c(-c3ccccc3)c(Cl)c(C3CCCCC3)nc2=O)cc1 |
|
~%
5-chloro-4-cycl... CAS#:88039-40-1 |
| Literature: Barluenga, Jose; Tomas, Miguel; Lopez-Ortiz, J. Francisco; Gotor, Vicente Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2273 - 2276 |
|
~%
5-chloro-4-cycl... CAS#:88039-40-1 |
| Literature: Barluenga, Jose; Tomas, Miguel; Lopez-Ortiz, J. Francisco; Gotor, Vicente Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2273 - 2276 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |