ethyl 2-(bromomethyl)-3-(2-chlorophenyl)prop-2-enoate structure
|
Common Name | ethyl 2-(bromomethyl)-3-(2-chlorophenyl)prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 88039-51-4 | Molecular Weight | 303.57900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12BrClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-(bromomethyl)-3-(2-chlorophenyl)prop-2-enoate |
|---|
| Molecular Formula | C12H12BrClO2 |
|---|---|
| Molecular Weight | 303.57900 |
| Exact Mass | 301.97100 |
| PSA | 26.30000 |
| LogP | 3.68140 |
| InChIKey | YZWMTHKWFZHDPL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=Cc1ccccc1Cl)CBr |
|
~%
ethyl 2-(bromom... CAS#:88039-51-4 |
| Literature: Ameer, Farouk; Drewes, Siegfried E.; Emslie, Neville D.; Kaye, Perry T.; Mann, R. Leigh Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2293 - 2295 |
|
~%
ethyl 2-(bromom... CAS#:88039-51-4 |
| Literature: Ameer, Farouk; Drewes, Siegfried E.; Emslie, Neville D.; Kaye, Perry T.; Mann, R. Leigh Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2293 - 2295 |
|
~%
ethyl 2-(bromom... CAS#:88039-51-4 |
| Literature: Ameer, Farouk; Drewes, Siegfried E.; Emslie, Neville D.; Kaye, Perry T.; Mann, R. Leigh Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2293 - 2295 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |