1-O-ethyl 5-O-methyl 2-acetyl-4-ethylidenepentanedioate structure
|
Common Name | 1-O-ethyl 5-O-methyl 2-acetyl-4-ethylidenepentanedioate | ||
|---|---|---|---|---|
| CAS Number | 88039-54-7 | Molecular Weight | 242.26800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-O-ethyl 5-O-methyl 2-acetyl-4-ethylidenepentanedioate |
|---|
| Molecular Formula | C12H18O5 |
|---|---|
| Molecular Weight | 242.26800 |
| Exact Mass | 242.11500 |
| PSA | 69.67000 |
| LogP | 1.26410 |
| InChIKey | YBORJJKRDYWSAO-UHFFFAOYSA-N |
| SMILES | CC=C(CC(C(C)=O)C(=O)OCC)C(=O)OC |
|
~%
1-O-ethyl 5-O-m... CAS#:88039-54-7 |
| Literature: Ameer, Farouk; Drewes, Siegfried E.; Emslie, Neville D.; Kaye, Perry T.; Mann, R. Leigh Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2293 - 2295 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |