diethyl 2-acetyl-4-butylidenepentanedioate structure
|
Common Name | diethyl 2-acetyl-4-butylidenepentanedioate | ||
|---|---|---|---|---|
| CAS Number | 88039-56-9 | Molecular Weight | 284.34800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H24O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 2-acetyl-4-butylidenepentanedioate |
|---|
| Molecular Formula | C15H24O5 |
|---|---|
| Molecular Weight | 284.34800 |
| Exact Mass | 284.16200 |
| PSA | 69.67000 |
| LogP | 2.43440 |
| InChIKey | SKARVZBTWPDMRZ-UHFFFAOYSA-N |
| SMILES | CCCC=C(CC(C(C)=O)C(=O)OCC)C(=O)OCC |
|
~%
diethyl 2-acety... CAS#:88039-56-9 |
| Literature: Ameer, Farouk; Drewes, Siegfried E.; Emslie, Neville D.; Kaye, Perry T.; Mann, R. Leigh Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2293 - 2295 |
|
~%
diethyl 2-acety... CAS#:88039-56-9 |
| Literature: Ameer, Farouk; Drewes, Siegfried E.; Emslie, Neville D.; Kaye, Perry T.; Mann, R. Leigh Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2293 - 2295 |
|
~%
diethyl 2-acety... CAS#:88039-56-9 |
| Literature: Ameer, Farouk; Drewes, Siegfried E.; Emslie, Neville D.; Kaye, Perry T.; Mann, R. Leigh Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2293 - 2295 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |