N-(1-chloroethenyl)-N,N'-bis(3-methoxyphenyl)ethanimidamide
Modify Date: 2025-09-25 12:20:17
N-(1-chloroethenyl)-N,N'-bis(3-methoxyphenyl)ethanimidamide structure
|
Common Name | N-(1-chloroethenyl)-N,N'-bis(3-methoxyphenyl)ethanimidamide | ||
|---|---|---|---|---|
| CAS Number | 88046-77-9 | Molecular Weight | 330.80900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H19ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(1-chloroethenyl)-N,N'-bis(3-methoxyphenyl)ethanimidamide |
|---|
| Molecular Formula | C18H19ClN2O2 |
|---|---|
| Molecular Weight | 330.80900 |
| Exact Mass | 330.11400 |
| PSA | 34.06000 |
| LogP | 4.97030 |
| InChIKey | PPGHIRRGOBNPFH-UHFFFAOYSA-N |
| SMILES | C=C(Cl)N(C(C)=Nc1cccc(OC)c1)c1cccc(OC)c1 |
|
~62%
N-(1-chloroethe... CAS#:88046-77-9 |
| Literature: Meth-Cohn, Otto; Westwood, Keith T. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 2089 - 2092 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |