2-chloro-3-hydroxy-6-nitro-4-prop-2-enylbenzaldehyde structure
|
Common Name | 2-chloro-3-hydroxy-6-nitro-4-prop-2-enylbenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 88062-17-3 | Molecular Weight | 241.62800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-3-hydroxy-6-nitro-4-prop-2-enylbenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H8ClNO4 |
|---|---|
| Molecular Weight | 241.62800 |
| Exact Mass | 241.01400 |
| PSA | 83.12000 |
| LogP | 3.01800 |
| InChIKey | VEIAJUBGRTVBTI-UHFFFAOYSA-N |
| SMILES | C=CCc1cc([N+](=O)[O-])c(C=O)c(Cl)c1O |
|
~47%
2-chloro-3-hydr... CAS#:88062-17-3 |
| Literature: Plattner; Parks Journal of Heterocyclic Chemistry, 1983 , vol. 20, # 4 p. 1059 - 1062 |
|
~%
2-chloro-3-hydr... CAS#:88062-17-3 |
| Literature: Plattner; Parks Journal of Heterocyclic Chemistry, 1983 , vol. 20, # 4 p. 1059 - 1062 |
| 2-chloro-3-hydroxy-6-nitro-4-propenylbenzaldehyde |