1-cyclohexyl-2,4,6-triphenylpyridin-1-ium,thiocyanate structure
|
Common Name | 1-cyclohexyl-2,4,6-triphenylpyridin-1-ium,thiocyanate | ||
|---|---|---|---|---|
| CAS Number | 88064-53-3 | Molecular Weight | 448.62200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H28N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-cyclohexyl-2,4,6-triphenylpyridin-1-ium,thiocyanate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C30H28N2S |
|---|---|
| Molecular Weight | 448.62200 |
| Exact Mass | 448.19700 |
| PSA | 27.67000 |
| LogP | 7.49468 |
| InChIKey | VDZMUGDCMNHVQI-UHFFFAOYSA-M |
| SMILES | N#C[S-].c1ccc(-c2cc(-c3ccccc3)[n+](C3CCCCC3)c(-c3ccccc3)c2)cc1 |
|
~%
1-cyclohexyl-2,... CAS#:88064-53-3 |
| Literature: Katritzky, Alan R.; Marquet, Jorge; Lloyd, Jeremy M.; Keay, James G. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1983 , # 9 p. 1435 - 1442 |
| 1-cyclohexyl-2,4,6-triphenylpyridinium thiocyanate |
| Pyridinium,1-cyclohexyl-2,4,6-triphenyl-,thiocyanate |