7-(8-oxo-6,7-dihydro-5H-naphthalen-2-yl)-3,4-dihydro-2H-naphthalen-1-one structure
|
Common Name | 7-(8-oxo-6,7-dihydro-5H-naphthalen-2-yl)-3,4-dihydro-2H-naphthalen-1-one | ||
|---|---|---|---|---|
| CAS Number | 88065-12-7 | Molecular Weight | 290.35600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-(8-oxo-6,7-dihydro-5H-naphthalen-2-yl)-3,4-dihydro-2H-naphthalen-1-one |
|---|
| Molecular Formula | C20H18O2 |
|---|---|
| Molecular Weight | 290.35600 |
| Exact Mass | 290.13100 |
| PSA | 34.14000 |
| LogP | 4.39160 |
| InChIKey | RBLLXSDPHPZFAW-UHFFFAOYSA-N |
| SMILES | O=C1CCCc2ccc(-c3ccc4c(c3)C(=O)CCC4)cc21 |
|
~59%
7-(8-oxo-6,7-di... CAS#:88065-12-7 |
| Literature: Katritzky, Alan R.; Marson, Charles M. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1983 , # 9 p. 1455 - 1462 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |