2-methyl-5,5-bis(phenylsulfanyl)heptan-4-ol structure
|
Common Name | 2-methyl-5,5-bis(phenylsulfanyl)heptan-4-ol | ||
|---|---|---|---|---|
| CAS Number | 88065-30-9 | Molecular Weight | 346.55000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H26OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-5,5-bis(phenylsulfanyl)heptan-4-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H26OS2 |
|---|---|
| Molecular Weight | 346.55000 |
| Exact Mass | 346.14300 |
| PSA | 70.83000 |
| LogP | 6.08430 |
| InChIKey | AXNGJUIJUITEQL-UHFFFAOYSA-N |
| SMILES | CCC(Sc1ccccc1)(Sc1ccccc1)C(O)CC(C)C |
|
~%
2-methyl-5,5-bi... CAS#:88065-30-9 |
| Literature: Durman, John; Elliott, Jason; McElroy, Andrew B.; Warren, Stuart Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 1237 - 1244 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 6-methyl-3,3-bisphenylthioheptan-4-ol |