tert-butyl 2-(3-bromopropanoylamino)benzoate structure
|
Common Name | tert-butyl 2-(3-bromopropanoylamino)benzoate | ||
|---|---|---|---|---|
| CAS Number | 88072-01-9 | Molecular Weight | 328.20200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl 2-(3-bromopropanoylamino)benzoate |
|---|
| Molecular Formula | C14H18BrNO3 |
|---|---|
| Molecular Weight | 328.20200 |
| Exact Mass | 327.04700 |
| PSA | 58.89000 |
| LogP | 4.01490 |
| InChIKey | VHEKQAYBKGKPOQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)c1ccccc1NC(=O)CCBr |
|
~60%
tert-butyl 2-(3... CAS#:88072-01-9 |
| Literature: Zrihen; Labia; Wakselman European Journal of Medicinal Chemistry, 1983 , vol. 18, # 4 p. 307 - 314 |
|
~%
tert-butyl 2-(3... CAS#:88072-01-9 |
| Literature: Zrihen; Labia; Wakselman European Journal of Medicinal Chemistry, 1983 , vol. 18, # 4 p. 307 - 314 |