methyl 4-(3-bromopropanoylamino)-3-methylbenzoate structure
|
Common Name | methyl 4-(3-bromopropanoylamino)-3-methylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 88072-10-0 | Molecular Weight | 300.14800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 4-(3-bromopropanoylamino)-3-methylbenzoate |
|---|
| Molecular Formula | C12H14BrNO3 |
|---|---|
| Molecular Weight | 300.14800 |
| Exact Mass | 299.01600 |
| PSA | 55.40000 |
| LogP | 2.57810 |
| InChIKey | OJAOWLRRLRMSHQ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(NC(=O)CCBr)c(C)c1 |
|
~49%
methyl 4-(3-bro... CAS#:88072-10-0 |
| Literature: Zrihen; Labia; Wakselman European Journal of Medicinal Chemistry, 1983 , vol. 18, # 4 p. 307 - 314 |
|
~%
methyl 4-(3-bro... CAS#:88072-10-0 |
| Literature: Zrihen; Labia; Wakselman European Journal of Medicinal Chemistry, 1983 , vol. 18, # 4 p. 307 - 314 |