methyl 3-(2-oxoazetidin-1-yl)benzoate structure
|
Common Name | methyl 3-(2-oxoazetidin-1-yl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 88072-15-5 | Molecular Weight | 205.21000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 3-(2-oxoazetidin-1-yl)benzoate |
|---|
| Molecular Formula | C11H11NO3 |
|---|---|
| Molecular Weight | 205.21000 |
| Exact Mass | 205.07400 |
| PSA | 46.61000 |
| LogP | 1.27490 |
| InChIKey | QELREHGCUJGIFA-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc(N2CCC2=O)c1 |
|
~51%
methyl 3-(2-oxo... CAS#:88072-15-5 |
| Literature: Zrihen; Labia; Wakselman European Journal of Medicinal Chemistry, 1983 , vol. 18, # 4 p. 307 - 314 |
|
~%
methyl 3-(2-oxo... CAS#:88072-15-5 |
| Literature: Zrihen; Labia; Wakselman European Journal of Medicinal Chemistry, 1983 , vol. 18, # 4 p. 307 - 314 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |