2-nitro-1-phenylhexane-1,5-dione structure
|
Common Name | 2-nitro-1-phenylhexane-1,5-dione | ||
|---|---|---|---|---|
| CAS Number | 88072-88-2 | Molecular Weight | 235.23600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-nitro-1-phenylhexane-1,5-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13NO4 |
|---|---|
| Molecular Weight | 235.23600 |
| Exact Mass | 235.08400 |
| PSA | 79.96000 |
| LogP | 2.40700 |
| InChIKey | HCXWSULTOMZVPF-UHFFFAOYSA-N |
| SMILES | CC(=O)CCC(C(=O)c1ccccc1)[N+](=O)[O-] |
|
~78%
2-nitro-1-pheny... CAS#:88072-88-2 |
| Literature: Ono, Noboru; Miyake, Hideyoshi; Kaji, Aritsune Journal of the Chemical Society, Chemical Communications, 1983 , # 16 p. 875 - 876 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,5-Hexanedione,2-nitro-1-phenyl |