4-ethyl-4-nitro-5-oxooctanal structure
|
Common Name | 4-ethyl-4-nitro-5-oxooctanal | ||
|---|---|---|---|---|
| CAS Number | 88072-93-9 | Molecular Weight | 215.24600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-ethyl-4-nitro-5-oxooctanal |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H17NO4 |
|---|---|
| Molecular Weight | 215.24600 |
| Exact Mass | 215.11600 |
| PSA | 79.96000 |
| LogP | 2.28340 |
| InChIKey | FLQBVKNDTRKLKT-UHFFFAOYSA-N |
| SMILES | CCCC(=O)C(CC)(CCC=O)[N+](=O)[O-] |
|
~84%
4-ethyl-4-nitro... CAS#:88072-93-9 |
| Literature: Ono, Noboru; Miyake, Hideyoshi; Kaji, Aritsune Journal of the Chemical Society, Chemical Communications, 1983 , # 16 p. 875 - 876 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| Octanal,4-ethyl-4-nitro-5-oxo |