ethyl N-(1-oxo-1-phenylpropan-2-yl)oxycarbamate structure
|
Common Name | ethyl N-(1-oxo-1-phenylpropan-2-yl)oxycarbamate | ||
|---|---|---|---|---|
| CAS Number | 88073-03-4 | Molecular Weight | 237.25200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl N-(1-oxo-1-phenylpropan-2-yl)oxycarbamate |
|---|
| Molecular Formula | C12H15NO4 |
|---|---|
| Molecular Weight | 237.25200 |
| Exact Mass | 237.10000 |
| PSA | 68.12000 |
| LogP | 2.13990 |
| InChIKey | GLYUJVNMVFXELM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NOC(C)C(=O)c1ccccc1 |
|
~%
ethyl N-(1-oxo-... CAS#:88073-03-4 |
| Literature: Consonni, Piero; Favara, Duccio; Omodei-Sale, Amedeo; Bartolini, Giuseppe; Ricci, Alfredo Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1983 , p. 967 - 974 |