2-(1-hydroxy-2-oxo-2-phenylethyl)isoindole-1,3-dione structure
|
Common Name | 2-(1-hydroxy-2-oxo-2-phenylethyl)isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 88073-06-7 | Molecular Weight | 281.26300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(1-hydroxy-2-oxo-2-phenylethyl)isoindole-1,3-dione |
|---|
| Molecular Formula | C16H11NO4 |
|---|---|
| Molecular Weight | 281.26300 |
| Exact Mass | 281.06900 |
| PSA | 74.68000 |
| LogP | 1.42180 |
| InChIKey | ROYZKXQNDIHJLK-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)C(O)N1C(=O)c2ccccc2C1=O |
|
~44%
2-(1-hydroxy-2-... CAS#:88073-06-7 |
| Literature: Consonni, Piero; Favara, Duccio; Omodei-Sale, Amedeo; Bartolini, Giuseppe; Ricci, Alfredo Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1983 , p. 967 - 974 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |