1-(3,4-dimethoxyphenyl)pyrrole-3-carbaldehyde
1-(3,4-dimethoxyphenyl)pyrrole-3-carbaldehyde structure
|
Common Name | 1-(3,4-dimethoxyphenyl)pyrrole-3-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 88075-89-2 | Molecular Weight | 231.24700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(3,4-dimethoxyphenyl)pyrrole-3-carbaldehyde |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H13NO3 |
|---|---|
| Molecular Weight | 231.24700 |
| Exact Mass | 231.09000 |
| PSA | 40.46000 |
| LogP | 2.30700 |
| InChIKey | ZEJILEBHJCCVIV-UHFFFAOYSA-N |
| SMILES | COc1ccc(-n2ccc(C=O)c2)cc1OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~58%
1-(3,4-dimethox... CAS#:88075-89-2 |
| Literature: Hamdan, Ali; Wasley, Jan W. F. Synthetic Communications, 1983 , vol. 13, # 9 p. 741 - 744 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-(3,4-dimethoxyphenyl)pyrrole-3-carbaldehyde? |
| A: Molecular weight of 1-(3,4-dimethoxyphenyl)pyrrole-3-carbaldehyde is 231.24700. |
| Q: What is the LogP of 1-(3,4-dimethoxyphenyl)pyrrole-3-carbaldehyde? |
| A: LogP of 1-(3,4-dimethoxyphenyl)pyrrole-3-carbaldehyde is 2.30700. |
| Q: What is the CAS number of 1-(3,4-dimethoxyphenyl)pyrrole-3-carbaldehyde? |
| A: CAS number of 1-(3,4-dimethoxyphenyl)pyrrole-3-carbaldehyde is 88075-89-2. |
| Q: What is the Chinese name of 88075-89-2? |
| A: Chinese name of 88075-89-2 is 88075-89-2. |
| Q: What is the polar surface area (PSA) of 1-(3,4-dimethoxyphenyl)pyrrole-3-carbaldehyde? |
| A: Polar surface area (PSA) of 1-(3,4-dimethoxyphenyl)pyrrole-3-carbaldehyde is 40.46000. |
| Q: What is the English name of 1-(3,4-dimethoxyphenyl)pyrrole-3-carbaldehyde? |
| A: The English name of 1-(3,4-dimethoxyphenyl)pyrrole-3-carbaldehyde is 1-(3,4-dimethoxyphenyl)pyrrole-3-carbaldehyde. |
| Q: What is the molecular formula of 1-(3,4-dimethoxyphenyl)pyrrole-3-carbaldehyde? |
| A: Molecular formula of 1-(3,4-dimethoxyphenyl)pyrrole-3-carbaldehyde is C13H13NO3. |
| Q: What are the upstream materials of 1-(3,4-dimethoxyphenyl)pyrrole-3-carbaldehyde? |
| A: Related upstream materials(CAS) of 1-(3,4-dimethoxyphenyl)pyrrole-3-carbaldehyde: 50634-05-4;6315-89-5. |
| Q: What is the SMILES notation of 1-(3,4-dimethoxyphenyl)pyrrole-3-carbaldehyde? |
| A: SMILES notation of 1-(3,4-dimethoxyphenyl)pyrrole-3-carbaldehyde is COc1ccc(-n2ccc(C=O)c2)cc1OC. |
| Q: What is the InChIKey of 1-(3,4-dimethoxyphenyl)pyrrole-3-carbaldehyde? |
| A: InChIKey of 1-(3,4-dimethoxyphenyl)pyrrole-3-carbaldehyde is ZEJILEBHJCCVIV-UHFFFAOYSA-N. |