(2-acetyl-4-phenylmethoxyphenyl) benzoate structure
|
Common Name | (2-acetyl-4-phenylmethoxyphenyl) benzoate | ||
|---|---|---|---|---|
| CAS Number | 88087-02-9 | Molecular Weight | 346.37600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-acetyl-4-phenylmethoxyphenyl) benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H18O4 |
|---|---|
| Molecular Weight | 346.37600 |
| Exact Mass | 346.12100 |
| PSA | 52.60000 |
| LogP | 4.68740 |
| InChIKey | LKRMNDZZXAFUJD-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc(OCc2ccccc2)ccc1OC(=O)c1ccccc1 |
|
~74%
(2-acetyl-4-phe... CAS#:88087-02-9 |
| Literature: Konishi, Fukuko; Esaki, Sachiko; Kamiya, Shintaro Agricultural and Biological Chemistry, 1983 , vol. 47, # 6 p. 1419 - 1430 |
|
~%
(2-acetyl-4-phe... CAS#:88087-02-9 |
| Literature: Bhalla; Mahal; Venkataraman Journal of the Chemical Society, 1935 , p. 868 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2-Benzoyloxy-5-benzyloxyacetophenone |