2-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-enal
![2-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-enal Structure](https://image.chemsrc.com/caspic/233/88088-33-9.png)
2-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-enal structure
|
Common Name | 2-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-enal | ||
|---|---|---|---|---|
| CAS Number | 88088-33-9 | Molecular Weight | 228.40300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H24O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-enal |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H24O2Si |
|---|---|
| Molecular Weight | 228.40300 |
| Exact Mass | 228.15500 |
| PSA | 26.30000 |
| LogP | 3.54190 |
| InChIKey | KIKWJHIYADJKOX-UHFFFAOYSA-N |
| SMILES | C=C(C)CC(C=O)O[Si](C)(C)C(C)(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-[tert-butyl(d... CAS#:88088-33-9 |
| Literature: Bremner, John A.S.; Colvin, Ernest W.; Gallacher, Gerard; MacLeod, Angus Tetrahedron Letters, 1983 , vol. 24, # 35 p. 3783 - 3786 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 2-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-enal? |
| A: LogP of 2-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-enal is 3.54190. |
| Q: What is the molecular weight of 2-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-enal? |
| A: Molecular weight of 2-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-enal is 228.40300. |
| Q: What is the Chinese name of 88088-33-9? |
| A: Chinese name of 88088-33-9 is 88088-33-9. |
| Q: What is the InChIKey of 2-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-enal? |
| A: InChIKey of 2-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-enal is KIKWJHIYADJKOX-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-enal? |
| A: SMILES notation of 2-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-enal is C=C(C)CC(C=O)O[Si](C)(C)C(C)(C)C. |
| Q: What is the CAS number of 2-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-enal? |
| A: CAS number of 2-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-enal is 88088-33-9. |
| Q: What are the upstream materials of 2-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-enal? |
| A: Related upstream materials(CAS) of 2-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-enal: 88088-32-8;18162-48-6. |
| Q: What is the English name of 2-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-enal? |
| A: The English name of 2-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-enal is 2-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-enal. |
| Q: What is the molecular formula of 2-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-enal? |
| A: Molecular formula of 2-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-enal is C12H24O2Si. |
| Q: What is the polar surface area (PSA) of 2-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-enal? |
| A: Polar surface area (PSA) of 2-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-enal is 26.30000. |