1-(cyclohex-3-en-1-ylmethylselanyl)-2-nitrobenzene structure
|
Common Name | 1-(cyclohex-3-en-1-ylmethylselanyl)-2-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 88090-53-3 | Molecular Weight | 296.22400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15NO2Se | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(cyclohex-3-en-1-ylmethylselanyl)-2-nitrobenzene |
|---|
| Molecular Formula | C13H15NO2Se |
|---|---|
| Molecular Weight | 296.22400 |
| Exact Mass | 297.02700 |
| PSA | 45.82000 |
| LogP | 3.22210 |
| InChIKey | MVOPDRKKZWDARE-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1[Se]CC1CC=CCC1 |
|
~95%
1-(cyclohex-3-e... CAS#:88090-53-3 |
| Literature: Gassman, Paul G.; Bonser, Steven M.; Mlinaric-Majerski, Kata Journal of the American Chemical Society, 1989 , vol. 111, # 7 p. 2652 - 2662 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |