1,3-bis(3,4-dimethoxyphenyl)thiourea structure
|
Common Name | 1,3-bis(3,4-dimethoxyphenyl)thiourea | ||
|---|---|---|---|---|
| CAS Number | 88101-27-3 | Molecular Weight | 348.41700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H20N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-bis(3,4-dimethoxyphenyl)thiourea |
|---|
| Molecular Formula | C17H20N2O4S |
|---|---|
| Molecular Weight | 348.41700 |
| Exact Mass | 348.11400 |
| PSA | 100.11000 |
| LogP | 3.82340 |
| InChIKey | IUZMHKFUWWQKFD-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(=S)Nc2ccc(OC)c(OC)c2)cc1OC |
|
~66%
1,3-bis(3,4-dim... CAS#:88101-27-3 |
| Literature: Broda, Witold; Dehmlow, Eckehard V. Liebigs Annalen der Chemie, 1983 , # 10 p. 1839 - 1843 |
|
~%
1,3-bis(3,4-dim... CAS#:88101-27-3 |
| Literature: Dyson; George; Hunter Journal of the Chemical Society, 1927 , p. 440 |
|
~%
1,3-bis(3,4-dim... CAS#:88101-27-3 |
| Literature: Dyson; George; Hunter Journal of the Chemical Society, 1927 , p. 440 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |