5-methyl-3-(3-methylphenyl)-1,3-thiazolidine-2,4-dione structure
|
Common Name | 5-methyl-3-(3-methylphenyl)-1,3-thiazolidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 88103-71-3 | Molecular Weight | 221.27600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-methyl-3-(3-methylphenyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H11NO2S |
|---|---|
| Molecular Weight | 221.27600 |
| Exact Mass | 221.05100 |
| PSA | 62.68000 |
| LogP | 2.64830 |
| InChIKey | MDYMMJLUNZZXGB-UHFFFAOYSA-N |
| SMILES | Cc1cccc(N2C(=O)SC(C)C2=O)c1 |
|
~%
5-methyl-3-(3-m... CAS#:88103-71-3 |
| Literature: Bhargava,P.N.; Ram,P. Journal of the Indian Chemical Society, 1961 , vol. 38, p. 127 - 129 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HMS1395N16 |
| 5-methyl-3-m-tolyl-thiazolidine-2,4-dione |
| 5-Methyl-3-m-tolyl-2,4-thiazolidion |