ethyl 4-[4-(3-chlorophenoxy)phenyl]-4-oxobut-2-enoate structure
|
Common Name | ethyl 4-[4-(3-chlorophenoxy)phenyl]-4-oxobut-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 88113-21-7 | Molecular Weight | 330.76200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H15ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 4-[4-(3-chlorophenoxy)phenyl]-4-oxobut-2-enoate |
|---|
| Molecular Formula | C18H15ClO4 |
|---|---|
| Molecular Weight | 330.76200 |
| Exact Mass | 330.06600 |
| PSA | 52.60000 |
| LogP | 4.43430 |
| InChIKey | KPYMPIYCXQNHOF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C=CC(=O)c1ccc(Oc2cccc(Cl)c2)cc1 |
|
~88%
ethyl 4-[4-(3-c... CAS#:88113-21-7 |
| Literature: Tomisawa; Kameo; Matsunaga; Saito; Hosoda; Asami; Sota Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 2 p. 701 - 712 |
|
~%
ethyl 4-[4-(3-c... CAS#:88113-21-7 |
| Literature: Taisho Pharmaceutical Co., Ltd. Patent: US4472316 A1, 1984 ; |
|
~%
ethyl 4-[4-(3-c... CAS#:88113-21-7 |
| Literature: Tomisawa; Kameo; Matsunaga; Saito; Hosoda; Asami; Sota Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 2 p. 701 - 712 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |