5-methylpyrido[4,3-b]indole-3-carbohydrazide structure
|
Common Name | 5-methylpyrido[4,3-b]indole-3-carbohydrazide | ||
|---|---|---|---|---|
| CAS Number | 88129-36-6 | Molecular Weight | 240.26100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-methylpyrido[4,3-b]indole-3-carbohydrazide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H12N4O |
|---|---|
| Molecular Weight | 240.26100 |
| Exact Mass | 240.10100 |
| PSA | 76.43000 |
| LogP | 2.60510 |
| InChIKey | QMCGRXVNICIABX-UHFFFAOYSA-N |
| SMILES | Cn1c2ccccc2c2cnc(C(=O)NN)cc21 |
|
~68%
5-methylpyrido[... CAS#:88129-36-6 |
| Literature: Dupas, Georges; Duflos, Jack; Queguiner, Guy Journal of Heterocyclic Chemistry, 1983 , vol. 20, p. 967 - 970 |
|
~%
5-methylpyrido[... CAS#:88129-36-6 |
| Literature: Dupas, Georges; Duflos, Jack; Queguiner, Guy Journal of Heterocyclic Chemistry, 1983 , vol. 20, p. 967 - 970 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-methyl-5H-pyrido<4,3-b>indole-3-carbonyl-hydrazine |
| methyl-5 hydrazinocarbonyl-3 <5H> pyrido<4,3-b>indole |