2,6-Dichloro-4-nitrobenzeneacetonitrile structure
|
Common Name | 2,6-Dichloro-4-nitrobenzeneacetonitrile | ||
|---|---|---|---|---|
| CAS Number | 88135-30-2 | Molecular Weight | 231.036 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 367.3±37.0 °C at 760 mmHg | |
| Molecular Formula | C8H4Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.9±26.5 °C | |
| Name | 2,6-dichloro-4-nitrobenzeneacetonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 367.3±37.0 °C at 760 mmHg |
| Molecular Formula | C8H4Cl2N2O2 |
| Molecular Weight | 231.036 |
| Flash Point | 175.9±26.5 °C |
| Exact Mass | 229.964981 |
| PSA | 69.61000 |
| LogP | 2.57 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | VHRGXLUIOTZSQL-UHFFFAOYSA-N |
| SMILES | N#CCc1c(Cl)cc([N+](=O)[O-])cc1Cl |
|
~96%
2,6-Dichloro-4-... CAS#:88135-30-2 |
| Literature: ADDEX PHARMA SA Patent: WO2008/117175 A2, 2008 ; Location in patent: Page/Page column 147-148 ; WO 2008/117175 A2 |
|
~%
2,6-Dichloro-4-... CAS#:88135-30-2 |
| Literature: IRM LLC Patent: WO2005/34869 A2, 2005 ; Location in patent: Page/Page column 28 ; WO 2005/034869 A2 |
|
~%
2,6-Dichloro-4-... CAS#:88135-30-2 |
| Literature: Freyne, Eddy J.; Lacrampe, Jean F.; Deroose, Frederik; Boeckx, Gustaaf M.; Willems, Marc; Embrechts, Werner; Coesemans, Erwin; Willems, Johan J.; Fortin, Jerome M.; Ligney, Yannick; Dillen, Lieve L.; Cools, Willy F.; Goossens, Jan; Corens, David; De Groot, Alex; Van Wauwe, Jean P. Journal of Medicinal Chemistry, 2005 , vol. 48, # 6 p. 2167 - 2175 |
| 2,6-dichloro-4-nitrobenzylnitrile |
| Benzenemethanol,2,6-dichloro-4-methoxy |
| (2,6-dichloro-4-methoxy-phenyl)-methanol |
| (2,6-Dichloro-4-nitrophenyl)acetonitrile |
| Benzeneacetonitrile, 2,6-dichloro-4-nitro- |
| 2,6-Dichlor-4-methoxybenzylalkohol |
| 2,5-DIBROMO-4-CHLORO-4,4,5-TIFLUOROPENTAN-1-OL |
| 2,6-dichloro-4-methoxybenzyl alcohol |
| (2,6-dichloro-4-nitro-phenyl)-acetonitrile |
| 2,6-Dichloro-4-nitrobenzeneacetonitrile |