Methyl 2-(4-(2-(trifluoromethyl)benzoyl)piperazin-1-yl)thiazole-5-carboxylate structure
|
Common Name | Methyl 2-(4-(2-(trifluoromethyl)benzoyl)piperazin-1-yl)thiazole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 881384-32-3 | Molecular Weight | 399.387 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 529.1±60.0 °C at 760 mmHg | |
| Molecular Formula | C17H16F3N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.8±32.9 °C | |
| Name | methyl 2-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-1,3-thiazole-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 529.1±60.0 °C at 760 mmHg |
| Molecular Formula | C17H16F3N3O3S |
| Molecular Weight | 399.387 |
| Flash Point | 273.8±32.9 °C |
| Exact Mass | 399.086456 |
| PSA | 90.98000 |
| LogP | 1.26 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | YZDUEAVIQFBCSU-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cnc(N2CCN(C(=O)c3ccccc3C(F)(F)F)CC2)s1 |
| HS Code | 2934100090 |
|---|
|
~%
Methyl 2-(4-(2-... CAS#:881384-32-3 |
| Literature: XENON PHARMACEUTICALS INC. Patent: US2008/108629 A1, 2008 ; Location in patent: Page/Page column 22-23 ; US 20080108629 A1 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Methyl 2-(4-(2-(trifluoromethyl)benzoyl)piperazin-1-yl)thiazole-5-carboxylate |
| 5-Thiazolecarboxylic acid, 2-[4-[2-(trifluoromethyl)benzoyl]-1-piperazinyl]-, methyl ester |
| 2-[4-(2-trifluoromethylbenzoyl)piperazin-1-yl]thiazole-5-carboxylic acid methyl ester |
| methyl 2-{4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl}-1,3-thiazole-5-carboxylate |
| Methyl 2-{4-[2-(trifluoromethyl)benzoyl]-1-piperazinyl}-1,3-thiazole-5-carboxylate |