2-chloro-6-phenylpyridine-4-carbaldehyde structure
|
Common Name | 2-chloro-6-phenylpyridine-4-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 881402-38-6 | Molecular Weight | 217.65100 | |
| Density | 1.268g/cm3 | Boiling Point | 372.6ºC at 760 mmHg | |
| Molecular Formula | C12H8ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.1ºC | |
| Name | 2-chloro-6-phenylpyridine-4-carbaldehyde |
|---|
| Density | 1.268g/cm3 |
|---|---|
| Boiling Point | 372.6ºC at 760 mmHg |
| Molecular Formula | C12H8ClNO |
| Molecular Weight | 217.65100 |
| Flash Point | 179.1ºC |
| Exact Mass | 217.02900 |
| PSA | 29.96000 |
| LogP | 3.21450 |
| Index of Refraction | 1.624 |
| InChIKey | OKEUFBMZLYKVAG-UHFFFAOYSA-N |
| SMILES | O=Cc1cc(Cl)nc(-c2ccccc2)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |