1-(Phenylsulfonyl)pyrrole-3-sulfonyl chloride structure
|
Common Name | 1-(Phenylsulfonyl)pyrrole-3-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 881406-26-4 | Molecular Weight | 305.75800 | |
| Density | 1.54g/cm3 | Boiling Point | 492.5ºC at 760 mmHg | |
| Molecular Formula | C10H8ClNO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.6ºC | |
| Name | 1-(benzenesulfonyl)pyrrole-3-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.54g/cm3 |
|---|---|
| Boiling Point | 492.5ºC at 760 mmHg |
| Molecular Formula | C10H8ClNO4S2 |
| Molecular Weight | 305.75800 |
| Flash Point | 251.6ºC |
| Exact Mass | 304.95800 |
| PSA | 89.97000 |
| LogP | 3.81420 |
| Index of Refraction | 1.645 |
| InChIKey | NICPBODIXJSKTB-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1ccn(S(=O)(=O)c2ccccc2)c1 |
| HS Code | 2933990090 |
|---|
|
~46%
1-(Phenylsulfon... CAS#:881406-26-4 |
| Literature: Janosik, Tomasz; Shirani, Hamid; Wahlstroem, Niklas; Malky, Ilham; Stensland, Birgitta; Bergman, Jan Tetrahedron, 2006 , vol. 62, # 8 p. 1699 - 1707 |
|
~%
1-(Phenylsulfon... CAS#:881406-26-4 |
| Literature: Janosik, Tomasz; Shirani, Hamid; Wahlstroem, Niklas; Malky, Ilham; Stensland, Birgitta; Bergman, Jan Tetrahedron, 2006 , vol. 62, # 8 p. 1699 - 1707 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| I11-789 |
| 1-(Phenylsulfonyl)pyrrole-3-sulfonyl chloride |
| 1-phenylsulfonyl-1H-pyrrole-3-sulfonyl chloride |